C18H34N6O3 — CID 111883741
tert-butyl N-[2-[[N-ethyl-N'-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]carbamimidoyl]amino]ethyl]carbamate (PubChem CID 111883741) has the molecular formula C18H34N6O3 and a molecular weight of 382.51 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-ethyl-N'-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]carbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N-ethyl-N'-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]carbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111883741 |
| Molecular Formula | C18H34N6O3 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | tert-butyl N-[2-[[N-ethyl-N'-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]carbamimidoyl]amino]ethyl]carbamate |
| SMILES | CCN/C(=N\CCCc1nc(C(C)C)no1)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H34N6O3/c1-7-19-16(21-11-12-22-17(25)26-18(4,5)6)20-10-8-9-14-23-15(13(2)3)24-27-14/h13H,7-12H2,1-6H3,(H,22,25)(H2,19,20,21) |
| InChIKey | MGJLDOLKEIYHTK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|