C17H28N6OS — CID 111932318
1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine (PubChem CID 111932318) has the molecular formula C17H28N6OS and a molecular weight of 364.52 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111932318 |
| Molecular Formula | C17H28N6OS |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCc1nc(C(C)C)no1)NCCc1csc(C)n1 |
| InChI | InChI=1S/C17H28N6OS/c1-5-18-17(20-10-8-14-11-25-13(4)21-14)19-9-6-7-15-22-16(12(2)3)23-24-15/h11-12H,5-10H2,1-4H3,(H2,18,19,20) |
| InChIKey | FXLDNHWFLPMTON-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|