C18H31N5O3 — CID 111887417
tert-butyl N-[3-[[N-ethyl-N'-[(6-methoxy-2-pyridinyl)methyl]carbamimidoyl]amino]propyl]carbamate (PubChem CID 111887417) has the molecular formula C18H31N5O3 and a molecular weight of 365.48 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-ethyl-N'-[(6-methoxy-2-pyridinyl)methyl]carbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N-ethyl-N'-[(6-methoxy-2-pyridinyl)methyl]carbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111887417 |
| Molecular Formula | C18H31N5O3 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | tert-butyl N-[3-[[N-ethyl-N'-[(6-methoxy-2-pyridinyl)methyl]carbamimidoyl]amino]propyl]carbamate |
| SMILES | CCN/C(=N\Cc1cccc(OC)n1)NCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31N5O3/c1-6-19-16(22-13-14-9-7-10-15(23-14)25-5)20-11-8-12-21-17(24)26-18(2,3)4/h7,9-10H,6,8,11-13H2,1-5H3,(H,21,24)(H2,19,20,22) |
| InChIKey | AKERTCSYRWCBDP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|