C16H29IN4O — CID 111943648
1-ethyl-2-[(6-methoxy-2-pyridinyl)methyl]-3-(4-methylpentyl)guanidine;hydroiodide (PubChem CID 111943648) has the molecular formula C16H29IN4O and a molecular weight of 420.34 g/mol. Its IUPAC name is 1-ethyl-2-[(6-methoxy-2-pyridinyl)methyl]-3-(4-methylpentyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(6-methoxy-2-pyridinyl)methyl]-3-(4-methylpentyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111943648 |
| Molecular Formula | C16H29IN4O |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 1-ethyl-2-[(6-methoxy-2-pyridinyl)methyl]-3-(4-methylpentyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OC)n1)NCCCC(C)C.I |
| InChI | InChI=1S/C16H28N4O.HI/c1-5-17-16(18-11-7-8-13(2)3)19-12-14-9-6-10-15(20-14)21-4;/h6,9-10,13H,5,7-8,11-12H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | HDJGWSDZVBGVNG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|