C16H20Cl2N6O — CID 111956033
3,4-dichloro-N-[2-[[N'-methyl-N-[(2-methylpyrazol-3-yl)methyl]carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111956033) has the molecular formula C16H20Cl2N6O and a molecular weight of 383.28 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[[N'-methyl-N-[(2-methylpyrazol-3-yl)methyl]carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[[N'-methyl-N-[(2-methylpyrazol-3-yl)methyl]carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111956033 |
| Molecular Formula | C16H20Cl2N6O |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 3,4-dichloro-N-[2-[[N'-methyl-N-[(2-methylpyrazol-3-yl)methyl]carbamimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(/NCCNC(=O)c1ccc(Cl)c(Cl)c1)NCc1ccnn1C |
| InChI | InChI=1S/C16H20Cl2N6O/c1-19-16(22-10-12-5-6-23-24(12)2)21-8-7-20-15(25)11-3-4-13(17)14(18)9-11/h3-6,9H,7-8,10H2,1-2H3,(H,20,25)(H2,19,21,22) |
| InChIKey | LSLRYWPUIBUNTM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|