C17H21Cl2IN4OS — CID 111893832
3,4-dichloro-N-[2-[[N'-methyl-N-[(3-methylthiophen-2-yl)methyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111893832) has the molecular formula C17H21Cl2IN4OS and a molecular weight of 527.26 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[[N'-methyl-N-[(3-methylthiophen-2-yl)methyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | 3,4-dichloro-N-[2-[[N'-methyl-N-[(3-methylthiophen-2-yl)methyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111893832 |
| Molecular Formula | C17H21Cl2IN4OS |
| Molecular Weight | 527.26 g/mol |
| Exact Mass | 525.99 |
| IUPAC Name | 3,4-dichloro-N-[2-[[N'-methyl-N-[(3-methylthiophen-2-yl)methyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | C/N=C(/NCCNC(=O)c1ccc(Cl)c(Cl)c1)NCc1sccc1C.I |
| InChI | InChI=1S/C17H20Cl2N4OS.HI/c1-11-5-8-25-15(11)10-23-17(20-2)22-7-6-21-16(24)12-3-4-13(18)14(19)9-12;/h3-5,8-9H,6-7,10H2,1-2H3,(H,21,24)(H2,20,22,23);1H |
| InChIKey | UUEQZOBVUBJXMF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.26 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|