C12H22IN5O2 — CID 111954330
methyl 3-[[N-ethyl-N'-[(2-methylpyrazol-3-yl)methyl]carbamimidoyl]amino]propanoate;hydroiodide (PubChem CID 111954330) has the molecular formula C12H22IN5O2 and a molecular weight of 395.25 g/mol. Its IUPAC name is methyl 3-[[N-ethyl-N'-[(2-methylpyrazol-3-yl)methyl]carbamimidoyl]amino]propanoate;hydroiodide.
| Compound Name | methyl 3-[[N-ethyl-N'-[(2-methylpyrazol-3-yl)methyl]carbamimidoyl]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111954330 |
| Molecular Formula | C12H22IN5O2 |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | methyl 3-[[N-ethyl-N'-[(2-methylpyrazol-3-yl)methyl]carbamimidoyl]amino]propanoate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnn1C)NCCC(=O)OC.I |
| InChI | InChI=1S/C12H21N5O2.HI/c1-4-13-12(14-7-6-11(18)19-3)15-9-10-5-8-16-17(10)2;/h5,8H,4,6-7,9H2,1-3H3,(H2,13,14,15);1H |
| InChIKey | IKDZLULUCRWBPI-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|