C13H27IN6 — CID 111954310
1-[3-(dimethylamino)propyl]-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111954310) has the molecular formula C13H27IN6 and a molecular weight of 394.31 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111954310 |
| Molecular Formula | C13H27IN6 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnn1C)NCCCN(C)C.I |
| InChI | InChI=1S/C13H26N6.HI/c1-5-14-13(15-8-6-10-18(2)3)16-11-12-7-9-17-19(12)4;/h7,9H,5-6,8,10-11H2,1-4H3,(H2,14,15,16);1H |
| InChIKey | YULWUUXEVFENIN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|