C21H36N8O2 — CID 111021627
1-ethyl-2-(2-morpholin-4-ylpropyl)-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 111021627) has the molecular formula C21H36N8O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 1-ethyl-2-(2-morpholin-4-ylpropyl)-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 1-ethyl-2-(2-morpholin-4-ylpropyl)-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111021627 |
| Molecular Formula | C21H36N8O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | 1-ethyl-2-(2-morpholin-4-ylpropyl)-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CC(C)N1CCOCC1)NCCC(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C21H36N8O2/c1-3-22-20(26-17-18(2)27-13-15-31-16-14-27)23-8-5-19(30)28-9-11-29(12-10-28)21-24-6-4-7-25-21/h4,6-7,18H,3,5,8-17H2,1-2H3,(H2,22,23,26) |
| InChIKey | KMRXNBSUFWLDLM-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|