C22H39N7O2 — CID 111715083
1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 111715083) has the molecular formula C22H39N7O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111715083 |
| Molecular Formula | C22H39N7O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.32 |
| IUPAC Name | 1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CC(CCO)CC(C)C)NCCC(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C22H39N7O2/c1-4-23-21(27-17-19(7-15-30)16-18(2)3)24-10-6-20(31)28-11-13-29(14-12-28)22-25-8-5-9-26-22/h5,8-9,18-19,30H,4,6-7,10-17H2,1-3H3,(H2,23,24,27) |
| InChIKey | BVGGCVFUZPESJP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|