C24H34IN7O — CID 111856825
1-ethyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-2-[(1-phenylcyclopropyl)methyl]guanidine;hydroiodide (PubChem CID 111856825) has the molecular formula C24H34IN7O and a molecular weight of 563.49 g/mol. Its IUPAC name is 1-ethyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-2-[(1-phenylcyclopropyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-2-[(1-phenylcyclopropyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111856825 |
| Molecular Formula | C24H34IN7O |
| Molecular Weight | 563.49 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | 1-ethyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-2-[(1-phenylcyclopropyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(c2ccccc2)CC1)NCCC(=O)N1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C24H33N7O.HI/c1-2-25-22(29-19-24(10-11-24)20-7-4-3-5-8-20)26-14-9-21(32)30-15-17-31(18-16-30)23-27-12-6-13-28-23;/h3-8,12-13H,2,9-11,14-19H2,1H3,(H2,25,26,29);1H |
| InChIKey | MAJSYESTGNQTSV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|