C21H39IN8O — CID 111022096
1-ethyl-2-(2-morpholin-4-ylpropyl)-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111022096) has the molecular formula C21H39IN8O and a molecular weight of 546.50 g/mol. Its IUPAC name is 1-ethyl-2-(2-morpholin-4-ylpropyl)-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-morpholin-4-ylpropyl)-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111022096 |
| Molecular Formula | C21H39IN8O |
| Molecular Weight | 546.50 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | 1-ethyl-2-(2-morpholin-4-ylpropyl)-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)N1CCOCC1)NCCCN1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C21H38N8O.HI/c1-3-22-20(26-18-19(2)28-14-16-30-17-15-28)23-8-5-9-27-10-12-29(13-11-27)21-24-6-4-7-25-21;/h4,6-7,19H,3,5,8-18H2,1-2H3,(H2,22,23,26);1H |
| InChIKey | AOYLVVGLYCKHEX-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.50 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|