C20H25FN6OS — CID 111765275
1-ethyl-2-[3-(4-fluorophenyl)sulfanylpropyl]-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]guanidine (PubChem CID 111765275) has the molecular formula C20H25FN6OS and a molecular weight of 416.53 g/mol. Its IUPAC name is 1-ethyl-2-[3-(4-fluorophenyl)sulfanylpropyl]-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]guanidine.
| Compound Name | 1-ethyl-2-[3-(4-fluorophenyl)sulfanylpropyl]-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111765275 |
| Molecular Formula | C20H25FN6OS |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 1-ethyl-2-[3-(4-fluorophenyl)sulfanylpropyl]-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]guanidine |
| SMILES | CCN/C(=N\CCCSc1ccc(F)cc1)NCCc1nc(-c2ccco2)n[nH]1 |
| InChI | InChI=1S/C20H25FN6OS/c1-2-22-20(23-11-4-14-29-16-8-6-15(21)7-9-16)24-12-10-18-25-19(27-26-18)17-5-3-13-28-17/h3,5-9,13H,2,4,10-12,14H2,1H3,(H2,22,23,24)(H,25,26,27) |
| InChIKey | ITHARIKCAKTBLU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|