C22H35N5O — CID 111398103
2-[3-(1H-benzimidazol-2-yl)propyl]-1-(3-cyclohexyloxypropyl)-3-ethylguanidine (PubChem CID 111398103) has the molecular formula C22H35N5O and a molecular weight of 385.56 g/mol. Its IUPAC name is 2-[3-(1H-benzimidazol-2-yl)propyl]-1-(3-cyclohexyloxypropyl)-3-ethylguanidine.
| Compound Name | 2-[3-(1H-benzimidazol-2-yl)propyl]-1-(3-cyclohexyloxypropyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111398103 |
| Molecular Formula | C22H35N5O |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | 2-[3-(1H-benzimidazol-2-yl)propyl]-1-(3-cyclohexyloxypropyl)-3-ethylguanidine |
| SMILES | CCN/C(=N\CCCc1nc2ccccc2[nH]1)NCCCOC1CCCCC1 |
| InChI | InChI=1S/C22H35N5O/c1-2-23-22(25-16-9-17-28-18-10-4-3-5-11-18)24-15-8-14-21-26-19-12-6-7-13-20(19)27-21/h6-7,12-13,18H,2-5,8-11,14-17H2,1H3,(H,26,27)(H2,23,24,25) |
| InChIKey | JDOZIKCLUBSTQM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|