C20H23F3IN5 — CID 111267448
1-[2-(1H-benzimidazol-2-yl)ethyl]-3-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111267448) has the molecular formula C20H23F3IN5 and a molecular weight of 517.34 g/mol. Its IUPAC name is 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111267448 |
| Molecular Formula | C20H23F3IN5 |
| Molecular Weight | 517.34 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCCc1nc2ccccc2[nH]1.I |
| InChI | InChI=1S/C20H22F3N5.HI/c1-2-24-19(26-13-14-6-5-7-15(12-14)20(21,22)23)25-11-10-18-27-16-8-3-4-9-17(16)28-18;/h3-9,12H,2,10-11,13H2,1H3,(H,27,28)(H2,24,25,26);1H |
| InChIKey | NBELLYZDQOOWFN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|