C20H25F3IN3OS — CID 111764718
1-(2-benzylsulfinylethyl)-3-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111764718) has the molecular formula C20H25F3IN3OS and a molecular weight of 539.41 g/mol. Its IUPAC name is 1-(2-benzylsulfinylethyl)-3-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-benzylsulfinylethyl)-3-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111764718 |
| Molecular Formula | C20H25F3IN3OS |
| Molecular Weight | 539.41 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | 1-(2-benzylsulfinylethyl)-3-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCCS(=O)Cc1ccccc1.I |
| InChI | InChI=1S/C20H24F3N3OS.HI/c1-2-24-19(25-11-12-28(27)15-16-7-4-3-5-8-16)26-14-17-9-6-10-18(13-17)20(21,22)23;/h3-10,13H,2,11-12,14-15H2,1H3,(H2,24,25,26);1H |
| InChIKey | ORXHEKYLPZHPHO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|