C19H26F2N4O2S — CID 109495449
2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-3-ethylguanidine (PubChem CID 109495449) has the molecular formula C19H26F2N4O2S and a molecular weight of 412.51 g/mol. Its IUPAC name is 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-3-ethylguanidine.
| Compound Name | 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 109495449 |
| Molecular Formula | C19H26F2N4O2S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC(F)F)cc1)NCCc1sc(C)nc1C |
| InChI | InChI=1S/C19H26F2N4O2S/c1-4-22-19(23-10-9-17-12(2)25-13(3)28-17)24-11-16(26)14-5-7-15(8-6-14)27-18(20)21/h5-8,16,18,26H,4,9-11H2,1-3H3,(H2,22,23,24) |
| InChIKey | IVFXYRFSMPLPIP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|