C21H27F2N3O3 — CID 109494943
2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-ethyl-3-[2-(3-methoxyphenyl)ethyl]guanidine (PubChem CID 109494943) has the molecular formula C21H27F2N3O3 and a molecular weight of 407.46 g/mol. Its IUPAC name is 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-ethyl-3-[2-(3-methoxyphenyl)ethyl]guanidine.
| Compound Name | 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-ethyl-3-[2-(3-methoxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 109494943 |
| Molecular Formula | C21H27F2N3O3 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-ethyl-3-[2-(3-methoxyphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC(F)F)cc1)NCCc1cccc(OC)c1 |
| InChI | InChI=1S/C21H27F2N3O3/c1-3-24-21(25-12-11-15-5-4-6-18(13-15)28-2)26-14-19(27)16-7-9-17(10-8-16)29-20(22)23/h4-10,13,19-20,27H,3,11-12,14H2,1-2H3,(H2,24,25,26) |
| InChIKey | FHXDGVYYGYYNKR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|