C19H24F2N4O4 — CID 109494527
N-[2-[[N'-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]ethyl]furan-2-carboxamide (PubChem CID 109494527) has the molecular formula C19H24F2N4O4 and a molecular weight of 410.42 g/mol. Its IUPAC name is N-[2-[[N'-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[N'-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 109494527 |
| Molecular Formula | C19H24F2N4O4 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | N-[2-[[N'-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]ethyl]furan-2-carboxamide |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC(F)F)cc1)NCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C19H24F2N4O4/c1-2-22-19(24-10-9-23-17(27)16-4-3-11-28-16)25-12-15(26)13-5-7-14(8-6-13)29-18(20)21/h3-8,11,15,18,26H,2,9-10,12H2,1H3,(H,23,27)(H2,22,24,25) |
| InChIKey | OYLUMXYCKNTIBM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|