C24H33FN4O3 — CID 109493733
N-[2-[[N-ethyl-N'-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide (PubChem CID 109493733) has the molecular formula C24H33FN4O3 and a molecular weight of 444.55 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide.
| Compound Name | N-[2-[[N-ethyl-N'-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 109493733 |
| Molecular Formula | C24H33FN4O3 |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC(C)C)cc1)NCCNC(=O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C24H33FN4O3/c1-4-26-24(28-13-12-27-23(31)15-18-6-5-7-20(25)14-18)29-16-22(30)19-8-10-21(11-9-19)32-17(2)3/h5-11,14,17,22,30H,4,12-13,15-16H2,1-3H3,(H,27,31)(H2,26,28,29) |
| InChIKey | CFWAOZGYRMITHF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|