C23H31ClN4O3 — CID 109493747
2-chloro-N-[2-[[N-ethyl-N'-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]carbamimidoyl]amino]ethyl]benzamide (PubChem CID 109493747) has the molecular formula C23H31ClN4O3 and a molecular weight of 446.98 g/mol. Its IUPAC name is 2-chloro-N-[2-[[N-ethyl-N'-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[N-ethyl-N'-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 109493747 |
| Molecular Formula | C23H31ClN4O3 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 2-chloro-N-[2-[[N-ethyl-N'-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]carbamimidoyl]amino]ethyl]benzamide |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC(C)C)cc1)NCCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C23H31ClN4O3/c1-4-25-23(27-14-13-26-22(30)19-7-5-6-8-20(19)24)28-15-21(29)17-9-11-18(12-10-17)31-16(2)3/h5-12,16,21,29H,4,13-15H2,1-3H3,(H,26,30)(H2,25,27,28) |
| InChIKey | FOLCQIWVHNSVOR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|