C21H36IN3O4 — CID 109493588
methyl 6-[[N-ethyl-N'-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]carbamimidoyl]amino]hexanoate;hydroiodide (PubChem CID 109493588) has the molecular formula C21H36IN3O4 and a molecular weight of 521.44 g/mol. Its IUPAC name is methyl 6-[[N-ethyl-N'-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]carbamimidoyl]amino]hexanoate;hydroiodide.
| Compound Name | methyl 6-[[N-ethyl-N'-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]carbamimidoyl]amino]hexanoate;hydroiodide |
|---|---|
| PubChem CID | 109493588 |
| Molecular Formula | C21H36IN3O4 |
| Molecular Weight | 521.44 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | methyl 6-[[N-ethyl-N'-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]carbamimidoyl]amino]hexanoate;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC(C)C)cc1)NCCCCCC(=O)OC.I |
| InChI | InChI=1S/C21H35N3O4.HI/c1-5-22-21(23-14-8-6-7-9-20(26)27-4)24-15-19(25)17-10-12-18(13-11-17)28-16(2)3;/h10-13,16,19,25H,5-9,14-15H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | UOPRAQZURIKHNE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|