C23H36IN5O2 — CID 109494320
1-ethyl-2-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide (PubChem CID 109494320) has the molecular formula C23H36IN5O2 and a molecular weight of 541.48 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109494320 |
| Molecular Formula | C23H36IN5O2 |
| Molecular Weight | 541.48 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC(C)C)cc1)NCCCCNc1ccccn1.I |
| InChI | InChI=1S/C23H35N5O2.HI/c1-4-24-23(27-16-8-7-15-26-22-9-5-6-14-25-22)28-17-21(29)19-10-12-20(13-11-19)30-18(2)3;/h5-6,9-14,18,21,29H,4,7-8,15-17H2,1-3H3,(H,25,26)(H2,24,27,28);1H |
| InChIKey | TVOBNPNKCAGCDQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|