C18H32IN3O4S — CID 109493932
1-ethyl-2-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-3-(3-methylsulfonylpropyl)guanidine;hydroiodide (PubChem CID 109493932) has the molecular formula C18H32IN3O4S and a molecular weight of 513.44 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-3-(3-methylsulfonylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-3-(3-methylsulfonylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109493932 |
| Molecular Formula | C18H32IN3O4S |
| Molecular Weight | 513.44 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-3-(3-methylsulfonylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC(C)C)cc1)NCCCS(C)(=O)=O.I |
| InChI | InChI=1S/C18H31N3O4S.HI/c1-5-19-18(20-11-6-12-26(4,23)24)21-13-17(22)15-7-9-16(10-8-15)25-14(2)3;/h7-10,14,17,22H,5-6,11-13H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | QZSPJVHLCFJZQV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|