C23H32F2IN3O3 — CID 109495228
2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-ethyl-3-(4-phenylmethoxybutyl)guanidine;hydroiodide (PubChem CID 109495228) has the molecular formula C23H32F2IN3O3 and a molecular weight of 563.43 g/mol. Its IUPAC name is 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-ethyl-3-(4-phenylmethoxybutyl)guanidine;hydroiodide.
| Compound Name | 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-ethyl-3-(4-phenylmethoxybutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109495228 |
| Molecular Formula | C23H32F2IN3O3 |
| Molecular Weight | 563.43 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-ethyl-3-(4-phenylmethoxybutyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC(F)F)cc1)NCCCCOCc1ccccc1.I |
| InChI | InChI=1S/C23H31F2N3O3.HI/c1-2-26-23(27-14-6-7-15-30-17-18-8-4-3-5-9-18)28-16-21(29)19-10-12-20(13-11-19)31-22(24)25;/h3-5,8-13,21-22,29H,2,6-7,14-17H2,1H3,(H2,26,27,28);1H |
| InChIKey | FATHNDZRBXTTKZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|