C19H25FN4O3 — CID 111684644
N-[2-[[N-ethyl-N'-[2-(2-fluorophenoxy)propyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide (PubChem CID 111684644) has the molecular formula C19H25FN4O3 and a molecular weight of 376.43 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[2-(2-fluorophenoxy)propyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[N-ethyl-N'-[2-(2-fluorophenoxy)propyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111684644 |
| Molecular Formula | C19H25FN4O3 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[2-(2-fluorophenoxy)propyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide |
| SMILES | CCN/C(=N\CC(C)Oc1ccccc1F)NCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C19H25FN4O3/c1-3-21-19(23-11-10-22-18(25)17-9-6-12-26-17)24-13-14(2)27-16-8-5-4-7-15(16)20/h4-9,12,14H,3,10-11,13H2,1-2H3,(H,22,25)(H2,21,23,24) |
| InChIKey | YXQMOZXAPXBCNF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|