C22H27F2N3O3 — CID 109495609
2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3-ethylguanidine (PubChem CID 109495609) has the molecular formula C22H27F2N3O3 and a molecular weight of 419.47 g/mol. Its IUPAC name is 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3-ethylguanidine.
| Compound Name | 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 109495609 |
| Molecular Formula | C22H27F2N3O3 |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC(F)F)cc1)NCCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C22H27F2N3O3/c1-2-25-22(26-11-9-15-3-8-20-17(13-15)10-12-29-20)27-14-19(28)16-4-6-18(7-5-16)30-21(23)24/h3-8,13,19,21,28H,2,9-12,14H2,1H3,(H2,25,26,27) |
| InChIKey | FWVXFXWEEHQEFD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|