C22H29FIN3O3 — CID 111985760
1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3-ethyl-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]guanidine;hydroiodide (PubChem CID 111985760) has the molecular formula C22H29FIN3O3 and a molecular weight of 529.39 g/mol. Its IUPAC name is 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3-ethyl-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3-ethyl-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111985760 |
| Molecular Formula | C22H29FIN3O3 |
| Molecular Weight | 529.39 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3-ethyl-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)COc1ccc(F)cc1)NCCc1ccc2c(c1)CCO2.I |
| InChI | InChI=1S/C22H28FN3O3.HI/c1-2-24-22(25-11-9-16-3-8-21-17(13-16)10-12-28-21)26-14-19(27)15-29-20-6-4-18(23)5-7-20;/h3-8,13,19,27H,2,9-12,14-15H2,1H3,(H2,24,25,26);1H |
| InChIKey | GNXDDEVTDSUMQR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|