C19H24F2IN5O3 — CID 109495376
2-[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]-N-pyridin-3-ylacetamide;hydroiodide (PubChem CID 109495376) has the molecular formula C19H24F2IN5O3 and a molecular weight of 535.33 g/mol. Its IUPAC name is 2-[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]-N-pyridin-3-ylacetamide;hydroiodide.
| Compound Name | 2-[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]-N-pyridin-3-ylacetamide;hydroiodide |
|---|---|
| PubChem CID | 109495376 |
| Molecular Formula | C19H24F2IN5O3 |
| Molecular Weight | 535.33 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | 2-[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]-N-pyridin-3-ylacetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1cccnc1)NCC(O)c1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C19H23F2N5O3.HI/c1-2-23-19(25-12-17(28)26-14-4-3-9-22-10-14)24-11-16(27)13-5-7-15(8-6-13)29-18(20)21;/h3-10,16,18,27H,2,11-12H2,1H3,(H,26,28)(H2,23,24,25);1H |
| InChIKey | MQJOUQAIYGKJPH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|