C23H30F2N4O3 — CID 109495031
N-[3-[[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]phenyl]butanamide (PubChem CID 109495031) has the molecular formula C23H30F2N4O3 and a molecular weight of 448.51 g/mol. Its IUPAC name is N-[3-[[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]phenyl]butanamide.
| Compound Name | N-[3-[[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 109495031 |
| Molecular Formula | C23H30F2N4O3 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | N-[3-[[[[[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1cccc(C/N=C(\NCC)NCC(O)c2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C23H30F2N4O3/c1-3-6-21(31)29-18-8-5-7-16(13-18)14-27-23(26-4-2)28-15-20(30)17-9-11-19(12-10-17)32-22(24)25/h5,7-13,20,22,30H,3-4,6,14-15H2,1-2H3,(H,29,31)(H2,26,27,28) |
| InChIKey | PMOMIIKGMZEPSC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|