C25H36N4O3 — CID 109491584
N-[3-[[[ethylamino-[[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]amino]methylidene]amino]methyl]phenyl]butanamide (PubChem CID 109491584) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]amino]methylidene]amino]methyl]phenyl]butanamide.
| Compound Name | N-[3-[[[ethylamino-[[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]amino]methylidene]amino]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 109491584 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | N-[3-[[[ethylamino-[[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]amino]methylidene]amino]methyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1cccc(C/N=C(\NCC)NCC(O)c2cccc(OC(C)C)c2)c1 |
| InChI | InChI=1S/C25H36N4O3/c1-5-9-24(31)29-21-12-7-10-19(14-21)16-27-25(26-6-2)28-17-23(30)20-11-8-13-22(15-20)32-18(3)4/h7-8,10-15,18,23,30H,5-6,9,16-17H2,1-4H3,(H,29,31)(H2,26,27,28) |
| InChIKey | MBJFTWNMVRPMBK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|