C20H27ClN4O2S — CID 111702148
N-[3-[[[[[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]phenyl]butanamide (PubChem CID 111702148) has the molecular formula C20H27ClN4O2S and a molecular weight of 422.98 g/mol. Its IUPAC name is N-[3-[[[[[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]phenyl]butanamide.
| Compound Name | N-[3-[[[[[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 111702148 |
| Molecular Formula | C20H27ClN4O2S |
| Molecular Weight | 422.98 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | N-[3-[[[[[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1cccc(C/N=C(\NCC)NCC(O)c2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C20H27ClN4O2S/c1-3-6-19(27)25-15-8-5-7-14(11-15)12-23-20(22-4-2)24-13-16(26)17-9-10-18(21)28-17/h5,7-11,16,26H,3-4,6,12-13H2,1-2H3,(H,25,27)(H2,22,23,24) |
| InChIKey | YVEIXWHVZZTRSE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.98 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|