C21H29ClN4O2S — CID 111701925
N-[3-[[[[[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]phenyl]-3-methylbutanamide (PubChem CID 111701925) has the molecular formula C21H29ClN4O2S and a molecular weight of 437.01 g/mol. Its IUPAC name is N-[3-[[[[[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]phenyl]-3-methylbutanamide.
| Compound Name | N-[3-[[[[[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 111701925 |
| Molecular Formula | C21H29ClN4O2S |
| Molecular Weight | 437.01 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | N-[3-[[[[[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]phenyl]-3-methylbutanamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)CC(C)C)c1)NCC(O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C21H29ClN4O2S/c1-4-23-21(25-13-17(27)18-8-9-19(22)29-18)24-12-15-6-5-7-16(11-15)26-20(28)10-14(2)3/h5-9,11,14,17,27H,4,10,12-13H2,1-3H3,(H,26,28)(H2,23,24,25) |
| InChIKey | NMINKMWFHOBDGZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.01 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|