C23H32FN3O3 — CID 109491699
1-ethyl-2-[[4-fluoro-3-(methoxymethyl)phenyl]methyl]-3-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine (PubChem CID 109491699) has the molecular formula C23H32FN3O3 and a molecular weight of 417.53 g/mol. Its IUPAC name is 1-ethyl-2-[[4-fluoro-3-(methoxymethyl)phenyl]methyl]-3-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[[4-fluoro-3-(methoxymethyl)phenyl]methyl]-3-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 109491699 |
| Molecular Formula | C23H32FN3O3 |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 1-ethyl-2-[[4-fluoro-3-(methoxymethyl)phenyl]methyl]-3-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(F)c(COC)c1)NCC(O)c1cccc(OC(C)C)c1 |
| InChI | InChI=1S/C23H32FN3O3/c1-5-25-23(26-13-17-9-10-21(24)19(11-17)15-29-4)27-14-22(28)18-7-6-8-20(12-18)30-16(2)3/h6-12,16,22,28H,5,13-15H2,1-4H3,(H2,25,26,27) |
| InChIKey | NJDCIDHXDOWGFA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|