C24H33N3O5 — CID 109492011
methyl 5-[[[ethylamino-[[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]amino]methylidene]amino]methyl]-2-methoxybenzoate (PubChem CID 109492011) has the molecular formula C24H33N3O5 and a molecular weight of 443.54 g/mol. Its IUPAC name is methyl 5-[[[ethylamino-[[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]amino]methylidene]amino]methyl]-2-methoxybenzoate.
| Compound Name | methyl 5-[[[ethylamino-[[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]amino]methylidene]amino]methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 109492011 |
| Molecular Formula | C24H33N3O5 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | methyl 5-[[[ethylamino-[[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]amino]methylidene]amino]methyl]-2-methoxybenzoate |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(C(=O)OC)c1)NCC(O)c1cccc(OC(C)C)c1 |
| InChI | InChI=1S/C24H33N3O5/c1-6-25-24(26-14-17-10-11-22(30-4)20(12-17)23(29)31-5)27-15-21(28)18-8-7-9-19(13-18)32-16(2)3/h7-13,16,21,28H,6,14-15H2,1-5H3,(H2,25,26,27) |
| InChIKey | RBSQVZDQBUJNEC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|