C9H21N5O — CID 104888425
N,N-diethyl-2-[[ethylamino(hydrazinyl)methylidene]amino]acetamide (PubChem CID 104888425) has the molecular formula C9H21N5O and a molecular weight of 215.30 g/mol. Its IUPAC name is N,N-diethyl-2-[[ethylamino(hydrazinyl)methylidene]amino]acetamide.
| Compound Name | N,N-diethyl-2-[[ethylamino(hydrazinyl)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 104888425 |
| Molecular Formula | C9H21N5O |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | N,N-diethyl-2-[[ethylamino(hydrazinyl)methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)N(CC)CC)NN |
| InChI | InChI=1S/C9H21N5O/c1-4-11-9(13-10)12-7-8(15)14(5-2)6-3/h4-7,10H2,1-3H3,(H2,11,12,13) |
| InChIKey | CEHOLZJWQFUPTE-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|