C7H18N4OS — CID 104888729
1-amino-3-ethyl-2-(2-methylsulfinylpropyl)guanidine (PubChem CID 104888729) has the molecular formula C7H18N4OS and a molecular weight of 206.31 g/mol. Its IUPAC name is 1-amino-3-ethyl-2-(2-methylsulfinylpropyl)guanidine.
| Compound Name | 1-amino-3-ethyl-2-(2-methylsulfinylpropyl)guanidine |
|---|---|
| PubChem CID | 104888729 |
| Molecular Formula | C7H18N4OS |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 1-amino-3-ethyl-2-(2-methylsulfinylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)S(C)=O)NN |
| InChI | InChI=1S/C7H18N4OS/c1-4-9-7(11-8)10-5-6(2)13(3)12/h6H,4-5,8H2,1-3H3,(H2,9,10,11) |
| InChIKey | CXZYZZSERQQBSA-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|