C9H22N4 — CID 116511844
1-amino-2,3-dibutylguanidine (PubChem CID 116511844) has the molecular formula C9H22N4 and a molecular weight of 186.30 g/mol. Its IUPAC name is 1-amino-2,3-dibutylguanidine.
| Compound Name | 1-amino-2,3-dibutylguanidine |
|---|---|
| PubChem CID | 116511844 |
| Molecular Formula | C9H22N4 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.18 |
| IUPAC Name | 1-amino-2,3-dibutylguanidine |
| SMILES | CCCC/N=C(\NN)NCCCC |
| InChI | InChI=1S/C9H22N4/c1-3-5-7-11-9(13-10)12-8-6-4-2/h3-8,10H2,1-2H3,(H2,11,12,13) |
| InChIKey | CIPYQYHZVADBGN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|