C9H20N3OP — CID 118879347
1,2-dibutyl-3-phosphorosoguanidine (PubChem CID 118879347) has the molecular formula C9H20N3OP and a molecular weight of 217.25 g/mol. Its IUPAC name is 1,2-dibutyl-3-phosphorosoguanidine.
| Compound Name | 1,2-dibutyl-3-phosphorosoguanidine |
|---|---|
| PubChem CID | 118879347 |
| Molecular Formula | C9H20N3OP |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 1,2-dibutyl-3-phosphorosoguanidine |
| SMILES | CCCC/N=C(/NCCCC)NP=O |
| InChI | InChI=1S/C9H20N3OP/c1-3-5-7-10-9(12-14-13)11-8-6-4-2/h3-8H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | NFOUNZUTNNUCBS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|