C10H21N3O2S — CID 99629255
2-[[(2S)-1,1-dioxothiolan-2-yl]methyl]-1,3-diethylguanidine (PubChem CID 99629255) has the molecular formula C10H21N3O2S and a molecular weight of 247.36 g/mol. Its IUPAC name is 2-[[(2S)-1,1-dioxothiolan-2-yl]methyl]-1,3-diethylguanidine.
| Compound Name | 2-[[(2S)-1,1-dioxothiolan-2-yl]methyl]-1,3-diethylguanidine |
|---|---|
| PubChem CID | 99629255 |
| Molecular Formula | C10H21N3O2S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-[[(2S)-1,1-dioxothiolan-2-yl]methyl]-1,3-diethylguanidine |
| SMILES | CCNC(=NC[C@@H]1CCCS1(=O)=O)NCC |
| InChI | InChI=1S/C10H21N3O2S/c1-3-11-10(12-4-2)13-8-9-6-5-7-16(9,14)15/h9H,3-8H2,1-2H3,(H2,11,12,13)/t9-/m0/s1 |
| InChIKey | TVNCHXIGBHBGQL-VIFPVBQESA-N |
| XLogP | 0.14 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|