2-[(1,1-dioxothiolan-2-yl)methylcarbamoylamino]pentanoic acid

C11H20N2O5S — CID 81040665

IUPAC2-[(1,1-dioxothiolan-2-yl)methylcarbamoylamino]pentanoic acid
SMILESCCCC(NC(=O)NCC1CCCS1(=O)=O)C(=O)O
InChIInChI=1S/C11H20N2O5S/c1-2-4-9(10(14)15)13-11(16)12-7-8-5-3-6-19(8,17)18/h8-9H,2-7H2,1H3,(H,14,15)(H2,12,13,16)
InChIKeyQDNWVNVVJAJVSJ-UHFFFAOYSA-N
MW292.36 g/mol
LogP0.12
Rot. Bonds6

About 2-[(1,1-dioxothiolan-2-yl)methylcarbamoylamino]pentanoic acid

2-[(1,1-dioxothiolan-2-yl)methylcarbamoylamino]pentanoic acid (PubChem CID 81040665) has the molecular formula C11H20N2O5S and a molecular weight of 292.36 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-2-yl)methylcarbamoylamino]pentanoic acid.

Molecular Properties

Compound Name2-[(1,1-dioxothiolan-2-yl)methylcarbamoylamino]pentanoic acid
PubChem CID81040665
Molecular FormulaC11H20N2O5S
Molecular Weight292.36 g/mol
Exact Mass292.11
IUPAC Name2-[(1,1-dioxothiolan-2-yl)methylcarbamoylamino]pentanoic acid
SMILESCCCC(NC(=O)NCC1CCCS1(=O)=O)C(=O)O
InChIInChI=1S/C11H20N2O5S/c1-2-4-9(10(14)15)13-11(16)12-7-8-5-3-6-19(8,17)18/h8-9H,2-7H2,1H3,(H,14,15)(H2,12,13,16)
InChIKeyQDNWVNVVJAJVSJ-UHFFFAOYSA-N
XLogP0.12
TPSA112.57 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.36
LogP ≤ 50.12
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2-[(1,1-dioxothiolan-2-yl)methylcarbamoylamino]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1,1-dioxothiolan-2-yl)methylcarbamoylamino]pentanoic acid?
The IUPAC name of 2-[(1,1-dioxothiolan-2-yl)methylcarbamoylamino]pentanoic acid (CID 81040665) is 2-[(1,1-dioxothiolan-2-yl)methylcarbamoylamino]pentanoic acid.
What is the SMILES notation for 2-[(1,1-dioxothiolan-2-yl)methylcarbamoylamino]pentanoic acid?
The canonical SMILES for 2-[(1,1-dioxothiolan-2-yl)methylcarbamoylamino]pentanoic acid is CCCC(NC(=O)NCC1CCCS1(=O)=O)C(=O)O.
What is the InChIKey of 2-[(1,1-dioxothiolan-2-yl)methylcarbamoylamino]pentanoic acid?
The InChIKey is QDNWVNVVJAJVSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O5S/c1-2-4-9(10(14)15)13-11(16)12-7-8-5-3-6-19(8,17)18/h8-9H,2-7H2,1H3,(H,14,15)(H2,12,13,16).
What are the key properties of 2-[(1,1-dioxothiolan-2-yl)methylcarbamoylamino]pentanoic acid?
2-[(1,1-dioxothiolan-2-yl)methylcarbamoylamino]pentanoic acid has a molecular weight of 292.36 g/mol, XLogP of 0.12, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,1-dioxothiolan-2-yl)methylcarbamoylamino]pentanoic acid is sourced from PubChem (CID 81040665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).