C15H25N3O3S — CID 167873077
1-(1-cyanocyclooctyl)-3-(1,1-dioxothian-4-yl)urea (PubChem CID 167873077) has the molecular formula C15H25N3O3S and a molecular weight of 327.45 g/mol. Its IUPAC name is 1-(1-cyanocyclooctyl)-3-(1,1-dioxothian-4-yl)urea.
| Compound Name | 1-(1-cyanocyclooctyl)-3-(1,1-dioxothian-4-yl)urea |
|---|---|
| PubChem CID | 167873077 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-(1-cyanocyclooctyl)-3-(1,1-dioxothian-4-yl)urea |
| SMILES | N#CC1(NC(=O)NC2CCS(=O)(=O)CC2)CCCCCCC1 |
| InChI | InChI=1S/C15H25N3O3S/c16-12-15(8-4-2-1-3-5-9-15)18-14(19)17-13-6-10-22(20,21)11-7-13/h13H,1-11H2,(H2,17,18,19) |
| InChIKey | NWZQXCFJXRUBTI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |