C9H16N2O4S — CID 115755745
1-(1,1-dioxothiolan-3-yl)-3-(oxolan-3-yl)urea (PubChem CID 115755745) has the molecular formula C9H16N2O4S and a molecular weight of 248.30 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(oxolan-3-yl)urea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(oxolan-3-yl)urea |
|---|---|
| PubChem CID | 115755745 |
| Molecular Formula | C9H16N2O4S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(oxolan-3-yl)urea |
| SMILES | O=C(NC1CCOC1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H16N2O4S/c12-9(10-7-1-3-15-5-7)11-8-2-4-16(13,14)6-8/h7-8H,1-6H2,(H2,10,11,12) |
| InChIKey | QYJYEKYDYWFLDU-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |