C9H16N2O2S — CID 63922147
3-[(1,1-dioxothian-3-yl)amino]butanenitrile (PubChem CID 63922147) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 3-[(1,1-dioxothian-3-yl)amino]butanenitrile.
| Compound Name | 3-[(1,1-dioxothian-3-yl)amino]butanenitrile |
|---|---|
| PubChem CID | 63922147 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 3-[(1,1-dioxothian-3-yl)amino]butanenitrile |
| SMILES | CC(CC#N)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H16N2O2S/c1-8(4-5-10)11-9-3-2-6-14(12,13)7-9/h8-9,11H,2-4,6-7H2,1H3 |
| InChIKey | ZBKOHJXAQLBOHR-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |