C10H20N2O4S2 — CID 106059860
3-(cyclopropylamino)-N-(1,1-dioxothiolan-3-yl)propane-1-sulfonamide (PubChem CID 106059860) has the molecular formula C10H20N2O4S2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 3-(cyclopropylamino)-N-(1,1-dioxothiolan-3-yl)propane-1-sulfonamide.
| Compound Name | 3-(cyclopropylamino)-N-(1,1-dioxothiolan-3-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 106059860 |
| Molecular Formula | C10H20N2O4S2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 3-(cyclopropylamino)-N-(1,1-dioxothiolan-3-yl)propane-1-sulfonamide |
| SMILES | O=S1(=O)CCC(NS(=O)(=O)CCCNC2CC2)C1 |
| InChI | InChI=1S/C10H20N2O4S2/c13-17(14)7-4-10(8-17)12-18(15,16)6-1-5-11-9-2-3-9/h9-12H,1-8H2 |
| InChIKey | PBLBMEYSSORBOI-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|