C9H19NO4S2 — CID 106513325
1,1-dioxo-N-(2-propylsulfonylethyl)thiolan-3-amine (PubChem CID 106513325) has the molecular formula C9H19NO4S2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 1,1-dioxo-N-(2-propylsulfonylethyl)thiolan-3-amine.
| Compound Name | 1,1-dioxo-N-(2-propylsulfonylethyl)thiolan-3-amine |
|---|---|
| PubChem CID | 106513325 |
| Molecular Formula | C9H19NO4S2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 1,1-dioxo-N-(2-propylsulfonylethyl)thiolan-3-amine |
| SMILES | CCCS(=O)(=O)CCNC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H19NO4S2/c1-2-5-15(11,12)7-4-10-9-3-6-16(13,14)8-9/h9-10H,2-8H2,1H3 |
| InChIKey | JFXLJROCHCRNOT-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |