C12H21N3O3S — CID 102693289
N-(2,2-diethyloxan-4-yl)-1H-pyrazole-5-sulfonamide (PubChem CID 102693289) has the molecular formula C12H21N3O3S and a molecular weight of 287.38 g/mol. Its IUPAC name is N-(2,2-diethyloxan-4-yl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(2,2-diethyloxan-4-yl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102693289 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N-(2,2-diethyloxan-4-yl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCC1(CC)CC(NS(=O)(=O)c2ccn[nH]2)CCO1 |
| InChI | InChI=1S/C12H21N3O3S/c1-3-12(4-2)9-10(6-8-18-12)15-19(16,17)11-5-7-13-14-11/h5,7,10,15H,3-4,6,8-9H2,1-2H3,(H,13,14) |
| InChIKey | WSEHXPGLOQVJHW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |