C15H30N2O3S — CID 83037279
N-(2,2-diethyloxan-4-yl)-1-piperidin-4-ylmethanesulfonamide (PubChem CID 83037279) has the molecular formula C15H30N2O3S and a molecular weight of 318.48 g/mol. Its IUPAC name is N-(2,2-diethyloxan-4-yl)-1-piperidin-4-ylmethanesulfonamide.
| Compound Name | N-(2,2-diethyloxan-4-yl)-1-piperidin-4-ylmethanesulfonamide |
|---|---|
| PubChem CID | 83037279 |
| Molecular Formula | C15H30N2O3S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | N-(2,2-diethyloxan-4-yl)-1-piperidin-4-ylmethanesulfonamide |
| SMILES | CCC1(CC)CC(NS(=O)(=O)CC2CCNCC2)CCO1 |
| InChI | InChI=1S/C15H30N2O3S/c1-3-15(4-2)11-14(7-10-20-15)17-21(18,19)12-13-5-8-16-9-6-13/h13-14,16-17H,3-12H2,1-2H3 |
| InChIKey | DBIVSPGMJNAONN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |