C13H23NO4 — CID 116538202
ethyl 3,3-dimethyl-2-(oxolan-3-ylcarbamoyl)butanoate (PubChem CID 116538202) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is ethyl 3,3-dimethyl-2-(oxolan-3-ylcarbamoyl)butanoate.
| Compound Name | ethyl 3,3-dimethyl-2-(oxolan-3-ylcarbamoyl)butanoate |
|---|---|
| PubChem CID | 116538202 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | ethyl 3,3-dimethyl-2-(oxolan-3-ylcarbamoyl)butanoate |
| SMILES | CCOC(=O)C(C(=O)NC1CCOC1)C(C)(C)C |
| InChI | InChI=1S/C13H23NO4/c1-5-18-12(16)10(13(2,3)4)11(15)14-9-6-7-17-8-9/h9-10H,5-8H2,1-4H3,(H,14,15) |
| InChIKey | RGWWZQBXSCBGHP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|