C17H31NO3 — CID 116538093
ethyl 2-[(2,4-dimethylcyclohexyl)carbamoyl]-3,3-dimethylbutanoate (PubChem CID 116538093) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is ethyl 2-[(2,4-dimethylcyclohexyl)carbamoyl]-3,3-dimethylbutanoate.
| Compound Name | ethyl 2-[(2,4-dimethylcyclohexyl)carbamoyl]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 116538093 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | ethyl 2-[(2,4-dimethylcyclohexyl)carbamoyl]-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(C(=O)NC1CCC(C)CC1C)C(C)(C)C |
| InChI | InChI=1S/C17H31NO3/c1-7-21-16(20)14(17(4,5)6)15(19)18-13-9-8-11(2)10-12(13)3/h11-14H,7-10H2,1-6H3,(H,18,19) |
| InChIKey | AHSFSRAGIYBQTL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|